C18H14F2N2O4S2 — CID 37311988
N-[2-(difluoromethoxy)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 37311988) has the molecular formula C18H14F2N2O4S2 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 37311988 |
| Molecular Formula | C18H14F2N2O4S2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H14F2N2O4S2/c19-18(20)26-15-5-2-1-4-14(15)21-17(23)12-7-9-13(10-8-12)22-28(24,25)16-6-3-11-27-16/h1-11,18,22H,(H,21,23) |
| InChIKey | IBVILAIRGNDGQS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |