C21H19F2N3O4S2 — CID 6177739
N-[(E)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6177739) has the molecular formula C21H19F2N3O4S2 and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[(E)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6177739 |
| Molecular Formula | C21H19F2N3O4S2 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC/C(=N\NC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H19F2N3O4S2/c1-2-18(14-7-11-17(12-8-14)30-21(22)23)24-25-20(27)15-5-9-16(10-6-15)26-32(28,29)19-4-3-13-31-19/h3-13,21,26H,2H2,1H3,(H,25,27)/b24-18+ |
| InChIKey | VVGSJYXUBKXTOG-HKOYGPOVSA-N |
| XLogP | 4.69 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|