C21H35Cl2N3O3S — CID 172910682
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[2-methoxy-4-(thiomorpholin-4-ylmethyl)phenoxy]propan-2-ol;dihydrochloride (PubChem CID 172910682) has the molecular formula C21H35Cl2N3O3S and a molecular weight of 480.50 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[2-methoxy-4-(thiomorpholin-4-ylmethyl)phenoxy]propan-2-ol;dihydrochloride.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[2-methoxy-4-(thiomorpholin-4-ylmethyl)phenoxy]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 172910682 |
| Molecular Formula | C21H35Cl2N3O3S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[2-methoxy-4-(thiomorpholin-4-ylmethyl)phenoxy]propan-2-ol;dihydrochloride |
| SMILES | COc1cc(CN2CCSCC2)ccc1OCC(O)CN1C[C@H]2CNC[C@H]2C1.Cl.Cl |
| InChI | InChI=1S/C21H33N3O3S.2ClH/c1-26-21-8-16(11-23-4-6-28-7-5-23)2-3-20(21)27-15-19(25)14-24-12-17-9-22-10-18(17)13-24;;/h2-3,8,17-19,22,25H,4-7,9-15H2,1H3;2*1H/t17-,18+,19?;; |
| InChIKey | IKZMOCNVOQEDRE-NUFBWWOMSA-N |
| XLogP | 1.98 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |