C21H21F4OSi — CID 22924542
CID 22924542 (PubChem CID 22924542) has the molecular formula C21H21F4OSi and a molecular weight of 393.48 g/mol.
| Compound Name | CID 22924542 |
|---|---|
| PubChem CID | 22924542 |
| Molecular Formula | C21H21F4OSi |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | — |
| SMILES | C/C=C/[Si]1CCC(c2ccc(-c3ccc(OC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C21H21F4OSi/c1-2-11-27-12-9-17(10-13-27)15-3-5-16(6-4-15)18-7-8-20(19(22)14-18)26-21(23,24)25/h2-8,11,14,17H,9-10,12-13H2,1H3/b11-2+ |
| InChIKey | OGVNOMVWKFIXMG-BIIKFXOESA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|