C25H30F4O — CID 19702571
2-fluoro-4-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]-1-(trifluoromethoxy)benzene (PubChem CID 19702571) has the molecular formula C25H30F4O and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 19702571 |
| Molecular Formula | C25H30F4O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-fluoro-4-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]-1-(trifluoromethoxy)benzene |
| SMILES | CCC(C)CCC1CCC(c2ccc(-c3ccc(OC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H30F4O/c1-3-17(2)4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-15-24(23(26)16-22)30-25(27,28)29/h10-19H,3-9H2,1-2H3 |
| InChIKey | AOUCKESIMSDTPN-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |