C17H13F5O — CID 162562342
4-cyclobutyl-2-fluoro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]benzene (PubChem CID 162562342) has the molecular formula C17H13F5O and a molecular weight of 328.28 g/mol. Its IUPAC name is 4-cyclobutyl-2-fluoro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 4-cyclobutyl-2-fluoro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 162562342 |
| Molecular Formula | C17H13F5O |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-cyclobutyl-2-fluoro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]benzene |
| SMILES | Fc1cc(-c2ccc(C3CCC3)cc2F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H13F5O/c18-14-8-11(10-2-1-3-10)4-6-13(14)12-5-7-16(15(19)9-12)23-17(20,21)22/h4-10H,1-3H2 |
| InChIKey | SVMLXDMVHUFNNT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |