C20H31OSi — CID 18984144
CID 18984144 (PubChem CID 18984144) has the molecular formula C20H31OSi and a molecular weight of 315.55 g/mol.
| Compound Name | CID 18984144 |
|---|---|
| PubChem CID | 18984144 |
| Molecular Formula | C20H31OSi |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | — |
| SMILES | CCC/C=C/[Si]1CCC(CCc2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C20H31OSi/c1-3-5-6-15-22-16-13-19(14-17-22)8-7-18-9-11-20(12-10-18)21-4-2/h6,9-12,15,19H,3-5,7-8,13-14,16-17H2,1-2H3/b15-6+ |
| InChIKey | QFXCGYDXUNJUQU-GIDUJCDVSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|