C24H26O — CID 19043960
1-butoxy-4-[(1E,5E)-6-(4-ethylphenyl)hexa-1,5-dien-3-ynyl]benzene (PubChem CID 19043960) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-butoxy-4-[(1E,5E)-6-(4-ethylphenyl)hexa-1,5-dien-3-ynyl]benzene.
| Compound Name | 1-butoxy-4-[(1E,5E)-6-(4-ethylphenyl)hexa-1,5-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 19043960 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-butoxy-4-[(1E,5E)-6-(4-ethylphenyl)hexa-1,5-dien-3-ynyl]benzene |
| SMILES | CCCCOc1ccc(/C=C/C#C/C=C/c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C24H26O/c1-3-5-20-25-24-18-16-23(17-19-24)11-9-7-6-8-10-22-14-12-21(4-2)13-15-22/h8-19H,3-5,20H2,1-2H3/b10-8+,11-9+ |
| InChIKey | IJDOEPTYCHPXKA-GFULKKFKSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|