C27H32 — CID 19043973
1-hexyl-4-[(1E,5E)-6-(4-propylphenyl)hexa-1,5-dien-3-ynyl]benzene (PubChem CID 19043973) has the molecular formula C27H32 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-hexyl-4-[(1E,5E)-6-(4-propylphenyl)hexa-1,5-dien-3-ynyl]benzene.
| Compound Name | 1-hexyl-4-[(1E,5E)-6-(4-propylphenyl)hexa-1,5-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 19043973 |
| Molecular Formula | C27H32 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-hexyl-4-[(1E,5E)-6-(4-propylphenyl)hexa-1,5-dien-3-ynyl]benzene |
| SMILES | CCCCCCc1ccc(/C=C/C#C/C=C/c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C27H32/c1-3-5-6-9-13-25-20-22-27(23-21-25)15-11-8-7-10-14-26-18-16-24(12-4-2)17-19-26/h10-11,14-23H,3-6,9,12-13H2,1-2H3/b14-10+,15-11+ |
| InChIKey | CXGZVQDCNLAOEU-WFYKWJGLSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|