C30H44O2 — CID 18657474
1-ethoxy-4-[[4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]methoxy]benzene (PubChem CID 18657474) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is 1-ethoxy-4-[[4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]methoxy]benzene.
| Compound Name | 1-ethoxy-4-[[4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 18657474 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 1-ethoxy-4-[[4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]methoxy]benzene |
| SMILES | CCCCCC1CCC(/C=C/C#CC2CCC(COc3ccc(OCC)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H44O2/c1-3-5-6-9-25-12-14-26(15-13-25)10-7-8-11-27-16-18-28(19-17-27)24-32-30-22-20-29(21-23-30)31-4-2/h7,10,20-23,25-28H,3-6,9,12-19,24H2,1-2H3/b10-7+ |
| InChIKey | KVBHBOOKJGWDPR-JXMROGBWSA-N |
| XLogP | 8.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|