C29H40O2 — CID 18657525
[4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate (PubChem CID 18657525) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is [4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate.
| Compound Name | [4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 18657525 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | [4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate |
| SMILES | CCCCCC1CCC(/C=C/C#CC2CCC(OC(=O)c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C29H40O2/c1-3-4-5-8-24-13-15-25(16-14-24)9-6-7-10-26-17-21-28(22-18-26)31-29(30)27-19-11-23(2)12-20-27/h6,9,11-12,19-20,24-26,28H,3-5,8,13-18,21-22H2,1-2H3/b9-6+ |
| InChIKey | OOFLEAJPBJSEKB-RMKNXTFCSA-N |
| XLogP | 7.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|