C27H36O2 — CID 18657477
[4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-ethylbenzoate (PubChem CID 18657477) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is [4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-ethylbenzoate.
| Compound Name | [4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 18657477 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC2CCC(C#C/C=C/C3CCC(CC)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36O2/c1-3-21-9-11-23(12-10-21)7-5-6-8-24-15-19-26(20-16-24)29-27(28)25-17-13-22(4-2)14-18-25/h5,7,13-14,17-18,21,23-24,26H,3-4,9-12,15-16,19-20H2,1-2H3/b7-5+ |
| InChIKey | GGYYZVUCSXAMHJ-FNORWQNLSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|