C18H18ClF3OSi — CID 123473619
1-chloro-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane (PubChem CID 123473619) has the molecular formula C18H18ClF3OSi and a molecular weight of 370.87 g/mol. Its IUPAC name is 1-chloro-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane.
| Compound Name | 1-chloro-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
|---|---|
| PubChem CID | 123473619 |
| Molecular Formula | C18H18ClF3OSi |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-chloro-4-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc(C3CC[SiH](Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C18H18ClF3OSi/c19-24-11-9-16(10-12-24)14-3-1-13(2-4-14)15-5-7-17(8-6-15)23-18(20,21)22/h1-8,16,24H,9-12H2 |
| InChIKey | DBGNEWOCFUCAJB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|