About 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane
1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane (PubChem CID 123681548) has the molecular formula C18H16ClF5OSi
and a molecular weight of 406.85 g/mol. Its IUPAC name is 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane.
Molecular Properties
| Compound Name | 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
| PubChem CID | 123681548 |
| Molecular Formula | C18H16ClF5OSi |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
| SMILES | Fc1cc(C2CC[SiH](Cl)CC2)cc(F)c1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16ClF5OSi/c19-26-7-5-11(6-8-26)13-9-15(20)17(16(21)10-13)12-1-3-14(4-2-12)25-18(22,23)24/h1-4,9-11,26H,5-8H2 |
| InChIKey | VXVKXZAJWIIMSH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane?
The IUPAC name of 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane (CID 123681548) is 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane.
What is the SMILES notation for 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane?
The canonical SMILES for 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane is Fc1cc(C2CC[SiH](Cl)CC2)cc(F)c1-c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane?
The InChIKey is VXVKXZAJWIIMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF5OSi/c19-26-7-5-11(6-8-26)13-9-15(20)17(16(21)10-13)12-1-3-14(4-2-12)25-18(22,23)24/h1-4,9-11,26H,5-8H2.
What are the key properties of 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane?
1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane has a molecular weight of 406.85 g/mol, XLogP of 6.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[3,5-difluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]silinane is sourced from PubChem (CID 123681548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).