C21H26FN — CID 58839698
4-(6-but-3-enyl-1,1,3,3-tetradeuterio-2,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)-2-fluorobenzonitrile (PubChem CID 58839698) has the molecular formula C21H26FN and a molecular weight of 315.47 g/mol. Its IUPAC name is 4-(6-but-3-enyl-1,1,3,3-tetradeuterio-2,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)-2-fluorobenzonitrile.
| Compound Name | 4-(6-but-3-enyl-1,1,3,3-tetradeuterio-2,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 58839698 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 4-(6-but-3-enyl-1,1,3,3-tetradeuterio-2,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)-2-fluorobenzonitrile |
| SMILES | [2H]C1([2H])CC2CC(CCC=C)CCC2C([2H])([2H])C1c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C21H26FN/c1-2-3-4-15-5-6-17-12-18(8-7-16(17)11-15)19-9-10-20(14-23)21(22)13-19/h2,9-10,13,15-18H,1,3-8,11-12H2/i8D2,12D2 |
| InChIKey | GOKPZEDHUNIPTL-FJVJJXCISA-N |
| XLogP | 5.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|