C21H14F6O2 — CID 138468685
[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl] 4-methylcyclohex-3-ene-1-carboxylate (PubChem CID 138468685) has the molecular formula C21H14F6O2 and a molecular weight of 412.33 g/mol. Its IUPAC name is [4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl] 4-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | [4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl] 4-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 138468685 |
| Molecular Formula | C21H14F6O2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl] 4-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=CCC(C(=O)Oc2cc(F)c3c(F)c(C#CC(F)(F)F)c(F)cc3c2)CC1 |
| InChI | InChI=1S/C21H14F6O2/c1-11-2-4-12(5-3-11)20(28)29-14-8-13-9-16(22)15(6-7-21(25,26)27)19(24)18(13)17(23)10-14/h2,8-10,12H,3-5H2,1H3 |
| InChIKey | HFQISDDRVPEKIM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|