C31H32F6 — CID 138459016
6-[4-(4-cyclohexylcyclohexen-1-yl)cyclohexyl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138459016) has the molecular formula C31H32F6 and a molecular weight of 518.59 g/mol. Its IUPAC name is 6-[4-(4-cyclohexylcyclohexen-1-yl)cyclohexyl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[4-(4-cyclohexylcyclohexen-1-yl)cyclohexyl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138459016 |
| Molecular Formula | C31H32F6 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 6-[4-(4-cyclohexylcyclohexen-1-yl)cyclohexyl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | Fc1cc2cc(C3CCC(C4=CCC(C5CCCCC5)CC4)CC3)cc(F)c2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C31H32F6/c32-27-18-25-16-24(17-28(33)29(25)30(34)26(27)14-15-31(35,36)37)23-12-10-22(11-13-23)21-8-6-20(7-9-21)19-4-2-1-3-5-19/h8,16-20,22-23H,1-7,9-13H2 |
| InChIKey | RQSRCWNODXZZBJ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|