C28H22F6O — CID 138459163
2-[6-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]oxane (PubChem CID 138459163) has the molecular formula C28H22F6O and a molecular weight of 488.47 g/mol. Its IUPAC name is 2-[6-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]oxane.
| Compound Name | 2-[6-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]oxane |
|---|---|
| PubChem CID | 138459163 |
| Molecular Formula | C28H22F6O |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[6-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]oxane |
| SMILES | Fc1cc2cc(-c3ccc4c(c3)CCC(C3CCCCO3)C4)cc(F)c2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C28H22F6O/c29-23-15-21-13-20(14-24(30)26(21)27(31)22(23)8-9-28(32,33)34)18-5-4-17-12-19(7-6-16(17)11-18)25-3-1-2-10-35-25/h4-5,11,13-15,19,25H,1-3,6-7,10,12H2 |
| InChIKey | KIHGVAMAYDFALN-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|