C22H18F6 — CID 138459075
1,3,8-trifluoro-6-(4-propylcyclohexen-1-yl)-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138459075) has the molecular formula C22H18F6 and a molecular weight of 396.37 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-(4-propylcyclohexen-1-yl)-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 1,3,8-trifluoro-6-(4-propylcyclohexen-1-yl)-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138459075 |
| Molecular Formula | C22H18F6 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1,3,8-trifluoro-6-(4-propylcyclohexen-1-yl)-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | CCCC1CC=C(c2cc(F)c3c(F)c(C#CC(F)(F)F)c(F)cc3c2)CC1 |
| InChI | InChI=1S/C22H18F6/c1-2-3-13-4-6-14(7-5-13)15-10-16-12-18(23)17(8-9-22(26,27)28)21(25)20(16)19(24)11-15/h6,10-13H,2-5,7H2,1H3 |
| InChIKey | JPVJFQVWGREDIY-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|