C26H24F6O2 — CID 138468731
5-methyl-2-[4-[(E)-2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethenyl]cyclohexyl]-1,3-dioxane (PubChem CID 138468731) has the molecular formula C26H24F6O2 and a molecular weight of 482.46 g/mol. Its IUPAC name is 5-methyl-2-[4-[(E)-2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethenyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-methyl-2-[4-[(E)-2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethenyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 138468731 |
| Molecular Formula | C26H24F6O2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 5-methyl-2-[4-[(E)-2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethenyl]cyclohexyl]-1,3-dioxane |
| SMILES | CC1COC(C2CCC(/C=C/c3cc(F)c4c(F)c(C#CC(F)(F)F)c(F)cc4c3)CC2)OC1 |
| InChI | InChI=1S/C26H24F6O2/c1-15-13-33-25(34-14-15)18-6-4-16(5-7-18)2-3-17-10-19-12-21(27)20(8-9-26(30,31)32)24(29)23(19)22(28)11-17/h2-3,10-12,15-16,18,25H,4-7,13-14H2,1H3/b3-2+ |
| InChIKey | LKWITDXMAULDDY-NSCUHMNNSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|