C31H32F8O — CID 138468331
6-[difluoro-[4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexyl]methoxy]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138468331) has the molecular formula C31H32F8O and a molecular weight of 572.58 g/mol. Its IUPAC name is 6-[difluoro-[4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexyl]methoxy]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[difluoro-[4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexyl]methoxy]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138468331 |
| Molecular Formula | C31H32F8O |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 6-[difluoro-[4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexyl]methoxy]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | CC1CCC2CC(C3CCC(C(F)(F)Oc4cc(F)c5c(F)c(C#CC(F)(F)F)c(F)cc5c4)CC3)CCC2C1 |
| InChI | InChI=1S/C31H32F8O/c1-17-2-3-21-13-20(5-4-19(21)12-17)18-6-8-23(9-7-18)31(38,39)40-24-14-22-15-26(32)25(10-11-30(35,36)37)29(34)28(22)27(33)16-24/h14-21,23H,2-9,12-13H2,1H3 |
| InChIKey | SXKSILGNBWXWKS-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|