C30H28F8O — CID 118900566
6-[4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 118900566) has the molecular formula C30H28F8O and a molecular weight of 556.54 g/mol. Its IUPAC name is 6-[4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 118900566 |
| Molecular Formula | C30H28F8O |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 6-[4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CC1CCC(C2CCC(C(F)(F)Oc3ccc(-c4cc(F)c5c(F)c(F)c(F)cc5c4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C30H28F8O/c1-15-2-4-16(5-3-15)17-6-8-20(9-7-17)30(37,38)39-24-11-10-21(26(33)28(24)35)18-12-19-14-23(32)27(34)29(36)25(19)22(31)13-18/h10-17,20H,2-9H2,1H3 |
| InChIKey | NQCLYQADKLEFKK-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|