C22H22F6O — CID 20808190
6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3,8-trifluoro-2-(trifluoromethoxy)naphthalene (PubChem CID 20808190) has the molecular formula C22H22F6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3,8-trifluoro-2-(trifluoromethoxy)naphthalene.
| Compound Name | 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3,8-trifluoro-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 20808190 |
| Molecular Formula | C22H22F6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3,8-trifluoro-2-(trifluoromethoxy)naphthalene |
| SMILES | C[C@@H]1CC[C@@H]2CC(c3cc(F)c4c(F)c(OC(F)(F)F)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C22H22F6O/c1-11-2-3-13-7-14(5-4-12(13)6-11)15-8-16-10-18(24)21(29-22(26,27)28)20(25)19(16)17(23)9-15/h8-14H,2-7H2,1H3/t11-,12?,13-,14?/m1/s1 |
| InChIKey | BVPIDYSFSWSYCT-NELGMTEASA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |