C22H22F6 — CID 20808211
3-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6,8-trifluoro-2-(trifluoromethyl)naphthalene (PubChem CID 20808211) has the molecular formula C22H22F6 and a molecular weight of 400.41 g/mol. Its IUPAC name is 3-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6,8-trifluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 3-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6,8-trifluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 20808211 |
| Molecular Formula | C22H22F6 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6,8-trifluoro-2-(trifluoromethyl)naphthalene |
| SMILES | C[C@@H]1CC[C@@H]2CC(c3cc4cc(F)cc(F)c4c(F)c3C(F)(F)F)CCC2C1 |
| InChI | InChI=1S/C22H22F6/c1-11-2-3-13-7-14(5-4-12(13)6-11)17-9-15-8-16(23)10-18(24)19(15)21(25)20(17)22(26,27)28/h8-14H,2-7H2,1H3/t11-,12?,13-,14?/m1/s1 |
| InChIKey | MPEQRDWWYNSBJG-NELGMTEASA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |