C24H20F4O2 — CID 144548688
2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)cyclohepta-1,3,6-trien-1-yl]phenyl]-5-methyl-1,3-dioxane (PubChem CID 144548688) has the molecular formula C24H20F4O2 and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)cyclohepta-1,3,6-trien-1-yl]phenyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)cyclohepta-1,3,6-trien-1-yl]phenyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 144548688 |
| Molecular Formula | C24H20F4O2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)cyclohepta-1,3,6-trien-1-yl]phenyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2ccc(C3=CC(F)=C(c4cc(F)c(F)c(F)c4)CC=C3)cc2)OC1 |
| InChI | InChI=1S/C24H20F4O2/c1-14-12-29-24(30-13-14)16-7-5-15(6-8-16)17-3-2-4-19(20(25)9-17)18-10-21(26)23(28)22(27)11-18/h2-3,5-11,14,24H,4,12-13H2,1H3 |
| InChIKey | PXPOFOSGPJGHHR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|