C19H18F4O — CID 58555755
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyloxolane (PubChem CID 58555755) has the molecular formula C19H18F4O and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyloxolane.
| Compound Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyloxolane |
|---|---|
| PubChem CID | 58555755 |
| Molecular Formula | C19H18F4O |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyloxolane |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)O1 |
| InChI | InChI=1S/C19H18F4O/c1-2-3-13-5-7-18(24-13)11-4-6-14(15(20)8-11)12-9-16(21)19(23)17(22)10-12/h4,6,8-10,13,18H,2-3,5,7H2,1H3 |
| InChIKey | WYLWBZNWXWKWIU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|