C23H26F4 — CID 58839945
1,2,3-trifluoro-5-[2-fluoro-4-(2,2,6-trideuterio-4-pentylcyclohexyl)phenyl]benzene (PubChem CID 58839945) has the molecular formula C23H26F4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-(2,2,6-trideuterio-4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-(2,2,6-trideuterio-4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 58839945 |
| Molecular Formula | C23H26F4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-(2,2,6-trideuterio-4-pentylcyclohexyl)phenyl]benzene |
| SMILES | [2H]C1CC(CCCCC)CC([2H])([2H])C1c1ccc(-c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C23H26F4/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-11-19(20(24)12-17)18-13-21(25)23(27)22(26)14-18/h10-16H,2-9H2,1H3/i8D,9D2 |
| InChIKey | DDLBOEVTDZIYCA-VWQYXNFYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|