C17H25I — CID 54568264
1-iodo-4-[(4R,6R)-2,2,6-trideuterio-4-pentylcyclohexyl]benzene (PubChem CID 54568264) has the molecular formula C17H25I and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-iodo-4-[(4R,6R)-2,2,6-trideuterio-4-pentylcyclohexyl]benzene.
| Compound Name | 1-iodo-4-[(4R,6R)-2,2,6-trideuterio-4-pentylcyclohexyl]benzene |
|---|---|
| PubChem CID | 54568264 |
| Molecular Formula | C17H25I |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-iodo-4-[(4R,6R)-2,2,6-trideuterio-4-pentylcyclohexyl]benzene |
| SMILES | [2H][C@@H]1C[C@@H](CCCCC)CC([2H])([2H])C1c1ccc(I)cc1 |
| InChI | InChI=1S/C17H25I/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h10-15H,2-9H2,1H3/t14-,15?/i8D,9D2/t8-,14-,15?/m1/s1 |
| InChIKey | ZVJXAYCOQJDVMP-DCVSWRCMSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|