C23H23F3 — CID 59967324
1,2,3-trifluoro-5-[2-[4-(2,2,6-trideuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene (PubChem CID 59967324) has the molecular formula C23H23F3 and a molecular weight of 359.45 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-[4-(2,2,6-trideuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-[4-(2,2,6-trideuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 59967324 |
| Molecular Formula | C23H23F3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-[4-(2,2,6-trideuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene |
| SMILES | [2H]C1CC(CCC)CC([2H])([2H])C1c1ccc(C#Cc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23F3/c1-2-3-16-6-10-19(11-7-16)20-12-8-17(9-13-20)4-5-18-14-21(24)23(26)22(25)15-18/h8-9,12-16,19H,2-3,6-7,10-11H2,1H3/i10D,11D2 |
| InChIKey | YYCNTUUQUSWFHS-RFZSEEEWSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|