C17H21I — CID 22123958
1-(2-iodoethynyl)-4-(4-propylcyclohexyl)benzene (PubChem CID 22123958) has the molecular formula C17H21I and a molecular weight of 352.26 g/mol. Its IUPAC name is 1-(2-iodoethynyl)-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-(2-iodoethynyl)-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 22123958 |
| Molecular Formula | C17H21I |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-(2-iodoethynyl)-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(C#CI)cc2)CC1 |
| InChI | InChI=1S/C17H21I/c1-2-3-14-4-8-16(9-5-14)17-10-6-15(7-11-17)12-13-18/h6-7,10-11,14,16H,2-5,8-9H2,1H3 |
| InChIKey | KNLXDVORGOQIOT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|