C20H21N — CID 22123959
5-[4-(4-propylcyclohexyl)phenyl]penta-2,4-diynenitrile (PubChem CID 22123959) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-[4-(4-propylcyclohexyl)phenyl]penta-2,4-diynenitrile.
| Compound Name | 5-[4-(4-propylcyclohexyl)phenyl]penta-2,4-diynenitrile |
|---|---|
| PubChem CID | 22123959 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-[4-(4-propylcyclohexyl)phenyl]penta-2,4-diynenitrile |
| SMILES | CCCC1CCC(c2ccc(C#CC#CC#N)cc2)CC1 |
| InChI | InChI=1S/C20H21N/c1-2-6-17-8-12-19(13-9-17)20-14-10-18(11-15-20)7-4-3-5-16-21/h10-11,14-15,17,19H,2,6,8-9,12-13H2,1H3 |
| InChIKey | UHLWTJOTWGEULE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|