C20H30Si — CID 21480252
trimethyl-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]silane (PubChem CID 21480252) has the molecular formula C20H30Si and a molecular weight of 298.55 g/mol. Its IUPAC name is trimethyl-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 21480252 |
| Molecular Formula | C20H30Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | trimethyl-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]silane |
| SMILES | CCCC1CCC(c2ccc(C#C[Si](C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H30Si/c1-5-6-17-7-11-19(12-8-17)20-13-9-18(10-14-20)15-16-21(2,3)4/h9-10,13-14,17,19H,5-8,11-12H2,1-4H3 |
| InChIKey | GWKNPFABMBPSKR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|