C23H23F3 — CID 58839853
1,2-difluoro-4-[2-[2-fluoro-4-(3,3,5,5-tetradeuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene (PubChem CID 58839853) has the molecular formula C23H23F3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-[2-fluoro-4-(3,3,5,5-tetradeuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene.
| Compound Name | 1,2-difluoro-4-[2-[2-fluoro-4-(3,3,5,5-tetradeuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 58839853 |
| Molecular Formula | C23H23F3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1,2-difluoro-4-[2-[2-fluoro-4-(3,3,5,5-tetradeuterio-4-propylcyclohexyl)phenyl]ethynyl]benzene |
| SMILES | [2H]C1([2H])CC(c2ccc(C#Cc3ccc(F)c(F)c3)c(F)c2)CC([2H])([2H])C1CCC |
| InChI | InChI=1S/C23H23F3/c1-2-3-16-4-8-18(9-5-16)20-12-11-19(22(25)15-20)10-6-17-7-13-21(24)23(26)14-17/h7,11-16,18H,2-5,8-9H2,1H3/i4D2,5D2 |
| InChIKey | CVBFSURNFWISNG-CQOLUAMGSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|