C21H30F2 — CID 173275885
1,2-difluoro-4-[(4R,5R)-2,2,3,3,5,6-hexadeuterio-4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 173275885) has the molecular formula C21H30F2 and a molecular weight of 326.50 g/mol. Its IUPAC name is 1,2-difluoro-4-[(4R,5R)-2,2,3,3,5,6-hexadeuterio-4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1,2-difluoro-4-[(4R,5R)-2,2,3,3,5,6-hexadeuterio-4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 173275885 |
| Molecular Formula | C21H30F2 |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 1,2-difluoro-4-[(4R,5R)-2,2,3,3,5,6-hexadeuterio-4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | [2H]C1C(c2ccc(F)c(F)c2)C([2H])([2H])C([2H])([2H])[C@H](C2CCC(CCC)CC2)[C@@H]1[2H] |
| InChI | InChI=1S/C21H30F2/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-20(22)21(23)14-19/h12-18H,2-11H2,1H3/t15?,16?,17-,18?/i8D,9D2,10D,11D2/t8-,10?,15?,16?,17-,18?/m1/s1 |
| InChIKey | FSWZOZXLWVWJAH-HMVHAZCVSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |