C23H24F2 — CID 54185149
1,2-difluoro-4-[2-[4-[(4R,6R)-2,2,6-trideuterio-4-propylcyclohexyl]phenyl]ethynyl]benzene (PubChem CID 54185149) has the molecular formula C23H24F2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-[4-[(4R,6R)-2,2,6-trideuterio-4-propylcyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 1,2-difluoro-4-[2-[4-[(4R,6R)-2,2,6-trideuterio-4-propylcyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 54185149 |
| Molecular Formula | C23H24F2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1,2-difluoro-4-[2-[4-[(4R,6R)-2,2,6-trideuterio-4-propylcyclohexyl]phenyl]ethynyl]benzene |
| SMILES | [2H][C@@H]1C[C@@H](CCC)CC([2H])([2H])C1c1ccc(C#Cc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H24F2/c1-2-3-17-6-11-20(12-7-17)21-13-8-18(9-14-21)4-5-19-10-15-22(24)23(25)16-19/h8-10,13-17,20H,2-3,6-7,11-12H2,1H3/t17-,20?/i11D,12D2/t11-,17-,20?/m1/s1 |
| InChIKey | PEOWZOPAGXRWRE-DNTVGXGVSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|