C20H19F5O — CID 58555826
2-[3-fluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-5-propyloxolane (PubChem CID 58555826) has the molecular formula C20H19F5O and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-[3-fluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-5-propyloxolane.
| Compound Name | 2-[3-fluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-5-propyloxolane |
|---|---|
| PubChem CID | 58555826 |
| Molecular Formula | C20H19F5O |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[3-fluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-5-propyloxolane |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(C(F)(F)F)c(F)c3)c(F)c2)O1 |
| InChI | InChI=1S/C20H19F5O/c1-2-3-14-6-9-19(26-14)13-4-7-15(17(21)11-13)12-5-8-16(18(22)10-12)20(23,24)25/h4-5,7-8,10-11,14,19H,2-3,6,9H2,1H3 |
| InChIKey | LTENJKCJISWLEA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |