C22H24F2O2 — CID 58021359
2-(4-but-3-enylphenyl)-5-(2,3-difluoro-4-methoxyphenyl)oxane (PubChem CID 58021359) has the molecular formula C22H24F2O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-(4-but-3-enylphenyl)-5-(2,3-difluoro-4-methoxyphenyl)oxane.
| Compound Name | 2-(4-but-3-enylphenyl)-5-(2,3-difluoro-4-methoxyphenyl)oxane |
|---|---|
| PubChem CID | 58021359 |
| Molecular Formula | C22H24F2O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-(4-but-3-enylphenyl)-5-(2,3-difluoro-4-methoxyphenyl)oxane |
| SMILES | C=CCCc1ccc(C2CCC(c3ccc(OC)c(F)c3F)CO2)cc1 |
| InChI | InChI=1S/C22H24F2O2/c1-3-4-5-15-6-8-16(9-7-15)19-12-10-17(14-26-19)18-11-13-20(25-2)22(24)21(18)23/h3,6-9,11,13,17,19H,1,4-5,10,12,14H2,2H3 |
| InChIKey | CHJGMDBHSVZVIP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|