C34H21F9N2O — CID 58383440
2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine (PubChem CID 58383440) has the molecular formula C34H21F9N2O and a molecular weight of 644.54 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine.
| Compound Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine |
|---|---|
| PubChem CID | 58383440 |
| Molecular Formula | C34H21F9N2O |
| Molecular Weight | 644.54 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine |
| SMILES | C/C=C/CCc1cnc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C34H21F9N2O/c1-2-3-4-5-18-16-44-33(45-17-18)19-6-8-23(25(35)10-19)20-11-27(37)31(28(38)12-20)34(42,43)46-22-7-9-24(26(36)15-22)21-13-29(39)32(41)30(40)14-21/h2-3,6-17H,4-5H2,1H3/b3-2+ |
| InChIKey | NXXMEHGOBBGFCO-NSCUHMNNSA-N |
| XLogP | 10.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.54 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|