C17H14F6N2O2 — CID 90293783
2-[difluoro-[3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]-5-propylpyrimidine (PubChem CID 90293783) has the molecular formula C17H14F6N2O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-[difluoro-[3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]-5-propylpyrimidine.
| Compound Name | 2-[difluoro-[3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 90293783 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[difluoro-[3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]methyl]-5-propylpyrimidine |
| SMILES | CCCc1cnc(C(F)(F)Oc2ccc(O/C=C/C(F)(F)F)c(F)c2)nc1 |
| InChI | InChI=1S/C17H14F6N2O2/c1-2-3-11-9-24-15(25-10-11)17(22,23)27-12-4-5-14(13(18)8-12)26-7-6-16(19,20)21/h4-10H,2-3H2,1H3/b7-6+ |
| InChIKey | FZBRGBMDRQKVTO-VOTSOKGWSA-N |
| XLogP | 5.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|