C22H14F6O — CID 139855515
6-(4-but-2-enoxy-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3,8-trifluoronaphthalene (PubChem CID 139855515) has the molecular formula C22H14F6O and a molecular weight of 408.34 g/mol. Its IUPAC name is 6-(4-but-2-enoxy-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3,8-trifluoronaphthalene.
| Compound Name | 6-(4-but-2-enoxy-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139855515 |
| Molecular Formula | C22H14F6O |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 6-(4-but-2-enoxy-2-fluorophenyl)-2-(2,2-difluoroethenyl)-1,3,8-trifluoronaphthalene |
| SMILES | CC=CCOc1ccc(-c2cc(F)c3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H14F6O/c1-2-3-6-29-14-4-5-15(18(24)10-14)12-7-13-9-17(23)16(11-20(26)27)22(28)21(13)19(25)8-12/h2-5,7-11H,6H2,1H3 |
| InChIKey | OFWIFRYEZVBFNC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|