C23H14F6O3 — CID 139855848
[6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 4-but-2-enoxy-2,6-difluorobenzoate (PubChem CID 139855848) has the molecular formula C23H14F6O3 and a molecular weight of 452.35 g/mol. Its IUPAC name is [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 4-but-2-enoxy-2,6-difluorobenzoate.
| Compound Name | [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 4-but-2-enoxy-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 139855848 |
| Molecular Formula | C23H14F6O3 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 4-but-2-enoxy-2,6-difluorobenzoate |
| SMILES | CC=CCOc1cc(F)c(C(=O)Oc2ccc3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C23H14F6O3/c1-2-3-6-31-14-9-18(25)21(19(26)10-14)23(30)32-13-4-5-15-12(7-13)8-17(24)16(22(15)29)11-20(27)28/h2-5,7-11H,6H2,1H3 |
| InChIKey | MRLDKSWZZGXAHH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|