C22H12F6O3 — CID 139856559
[6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 2,6-difluoro-4-prop-2-enoxybenzoate (PubChem CID 139856559) has the molecular formula C22H12F6O3 and a molecular weight of 438.32 g/mol. Its IUPAC name is [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 2,6-difluoro-4-prop-2-enoxybenzoate.
| Compound Name | [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 2,6-difluoro-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 139856559 |
| Molecular Formula | C22H12F6O3 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | [6-(2,2-difluoroethenyl)-5,7-difluoronaphthalen-2-yl] 2,6-difluoro-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1cc(F)c(C(=O)Oc2ccc3c(F)c(C=C(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H12F6O3/c1-2-5-30-13-8-17(24)20(18(25)9-13)22(29)31-12-3-4-14-11(6-12)7-16(23)15(21(14)28)10-19(26)27/h2-4,6-10H,1,5H2 |
| InChIKey | MSABRNOWVRKJAZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|