C21H15F3O2 — CID 139853907
(5-fluoronaphthalen-2-yl) 4-but-3-enyl-2,6-difluorobenzoate (PubChem CID 139853907) has the molecular formula C21H15F3O2 and a molecular weight of 356.34 g/mol. Its IUPAC name is (5-fluoronaphthalen-2-yl) 4-but-3-enyl-2,6-difluorobenzoate.
| Compound Name | (5-fluoronaphthalen-2-yl) 4-but-3-enyl-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 139853907 |
| Molecular Formula | C21H15F3O2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (5-fluoronaphthalen-2-yl) 4-but-3-enyl-2,6-difluorobenzoate |
| SMILES | C=CCCc1cc(F)c(C(=O)Oc2ccc3c(F)cccc3c2)c(F)c1 |
| InChI | InChI=1S/C21H15F3O2/c1-2-3-5-13-10-18(23)20(19(24)11-13)21(25)26-15-8-9-16-14(12-15)6-4-7-17(16)22/h2,4,6-12H,1,3,5H2 |
| InChIKey | REEUXOQSDGSOTM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|