C19H14F5NO2 — CID 21138550
[3-fluoro-4-(methylideneamino)phenyl] 4-(5,5-difluoropent-4-enyl)-2,6-difluorobenzoate (PubChem CID 21138550) has the molecular formula C19H14F5NO2 and a molecular weight of 383.32 g/mol. Its IUPAC name is [3-fluoro-4-(methylideneamino)phenyl] 4-(5,5-difluoropent-4-enyl)-2,6-difluorobenzoate.
| Compound Name | [3-fluoro-4-(methylideneamino)phenyl] 4-(5,5-difluoropent-4-enyl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 21138550 |
| Molecular Formula | C19H14F5NO2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [3-fluoro-4-(methylideneamino)phenyl] 4-(5,5-difluoropent-4-enyl)-2,6-difluorobenzoate |
| SMILES | C=Nc1ccc(OC(=O)c2c(F)cc(CCCC=C(F)F)cc2F)cc1F |
| InChI | InChI=1S/C19H14F5NO2/c1-25-16-7-6-12(10-13(16)20)27-19(26)18-14(21)8-11(9-15(18)22)4-2-3-5-17(23)24/h5-10H,1-4H2 |
| InChIKey | PSXIKUXSYDINLE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|