About (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate
(3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate (PubChem CID 71441516) has the molecular formula C17H12FNO2S
and a molecular weight of 313.35 g/mol. Its IUPAC name is (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate.
Molecular Properties
| Compound Name | (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate |
| PubChem CID | 71441516 |
| Molecular Formula | C17H12FNO2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate |
| SMILES | C=CCc1ccc(C(=O)Oc2ccc(N=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C17H12FNO2S/c1-2-3-12-4-6-13(7-5-12)17(20)21-14-8-9-16(19-11-22)15(18)10-14/h2,4-10H,1,3H2 |
| InChIKey | ZZIAKCIQCNIYST-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate?
The IUPAC name of (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate (CID 71441516) is (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate.
What is the SMILES notation for (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate?
The canonical SMILES for (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate is C=CCc1ccc(C(=O)Oc2ccc(N=C=S)c(F)c2)cc1.
What is the InChIKey of (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate?
The InChIKey is ZZIAKCIQCNIYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FNO2S/c1-2-3-12-4-6-13(7-5-12)17(20)21-14-8-9-16(19-11-22)15(18)10-14/h2,4-10H,1,3H2.
What are the key properties of (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate?
(3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate has a molecular weight of 313.35 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-isothiocyanatophenyl) 4-prop-2-enylbenzoate is sourced from PubChem (CID 71441516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).