About (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate
(3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate (PubChem CID 70599863) has the molecular formula C17H12ClNO2
and a molecular weight of 297.74 g/mol. Its IUPAC name is (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate.
Molecular Properties
| Compound Name | (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate |
| PubChem CID | 70599863 |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate |
| SMILES | C=CCc1ccc(C(=O)Oc2ccc(C#N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H12ClNO2/c1-2-3-12-4-6-13(7-5-12)17(20)21-15-9-8-14(11-19)16(18)10-15/h2,4-10H,1,3H2 |
| InChIKey | KLOHAKBMHXUTLQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate?
The IUPAC name of (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate (CID 70599863) is (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate.
What is the SMILES notation for (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate?
The canonical SMILES for (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate is C=CCc1ccc(C(=O)Oc2ccc(C#N)c(Cl)c2)cc1.
What is the InChIKey of (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate?
The InChIKey is KLOHAKBMHXUTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClNO2/c1-2-3-12-4-6-13(7-5-12)17(20)21-15-9-8-14(11-19)16(18)10-15/h2,4-10H,1,3H2.
What are the key properties of (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate?
(3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate has a molecular weight of 297.74 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-cyanophenyl) 4-prop-2-enylbenzoate is sourced from PubChem (CID 70599863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).