About (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate
(3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate (PubChem CID 57036444) has the molecular formula C24H20ClNO3
and a molecular weight of 405.88 g/mol. Its IUPAC name is (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate.
Molecular Properties
| Compound Name | (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate |
| PubChem CID | 57036444 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate |
| SMILES | CCCCc1cc(O)ccc1-c1ccc(C(=O)Oc2ccc(C#N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H20ClNO3/c1-2-3-4-18-13-20(27)10-12-22(18)16-5-7-17(8-6-16)24(28)29-21-11-9-19(15-26)23(25)14-21/h5-14,27H,2-4H2,1H3 |
| InChIKey | VFJAVYLBMZVHSW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate?
The IUPAC name of (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate (CID 57036444) is (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate.
What is the SMILES notation for (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate?
The canonical SMILES for (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate is CCCCc1cc(O)ccc1-c1ccc(C(=O)Oc2ccc(C#N)c(Cl)c2)cc1.
What is the InChIKey of (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate?
The InChIKey is VFJAVYLBMZVHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClNO3/c1-2-3-4-18-13-20(27)10-12-22(18)16-5-7-17(8-6-16)24(28)29-21-11-9-19(15-26)23(25)14-21/h5-14,27H,2-4H2,1H3.
What are the key properties of (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate?
(3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate has a molecular weight of 405.88 g/mol, XLogP of 6.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-cyanophenyl) 4-(2-butyl-4-hydroxyphenyl)benzoate is sourced from PubChem (CID 57036444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).