C22H25ClN2O3 — CID 54476833
(3-chloro-4-cyanophenyl) 5-nonoxypyridine-2-carboxylate (PubChem CID 54476833) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is (3-chloro-4-cyanophenyl) 5-nonoxypyridine-2-carboxylate.
| Compound Name | (3-chloro-4-cyanophenyl) 5-nonoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 54476833 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (3-chloro-4-cyanophenyl) 5-nonoxypyridine-2-carboxylate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(C#N)c(Cl)c2)nc1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-2-3-4-5-6-7-8-13-27-19-11-12-21(25-16-19)22(26)28-18-10-9-17(15-24)20(23)14-18/h9-12,14,16H,2-8,13H2,1H3 |
| InChIKey | XMEIBIKOCBJSRO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|