C27H32ClNO5 — CID 19847106
(4-octoxyphenyl) 4-(2-chloro-3-methylbutanoyl)oxy-3-cyanobenzoate (PubChem CID 19847106) has the molecular formula C27H32ClNO5 and a molecular weight of 486.01 g/mol. Its IUPAC name is (4-octoxyphenyl) 4-(2-chloro-3-methylbutanoyl)oxy-3-cyanobenzoate.
| Compound Name | (4-octoxyphenyl) 4-(2-chloro-3-methylbutanoyl)oxy-3-cyanobenzoate |
|---|---|
| PubChem CID | 19847106 |
| Molecular Formula | C27H32ClNO5 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (4-octoxyphenyl) 4-(2-chloro-3-methylbutanoyl)oxy-3-cyanobenzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(OC(=O)C(Cl)C(C)C)c(C#N)c2)cc1 |
| InChI | InChI=1S/C27H32ClNO5/c1-4-5-6-7-8-9-16-32-22-11-13-23(14-12-22)33-26(30)20-10-15-24(21(17-20)18-29)34-27(31)25(28)19(2)3/h10-15,17,19,25H,4-9,16H2,1-3H3 |
| InChIKey | PKWDAKUZPTXADX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|