C20H8F8O2 — CID 122500654
4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorobenzaldehyde (PubChem CID 122500654) has the molecular formula C20H8F8O2 and a molecular weight of 432.27 g/mol. Its IUPAC name is 4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorobenzaldehyde.
| Compound Name | 4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 122500654 |
| Molecular Formula | C20H8F8O2 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)c(C(F)(F)Oc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C20H8F8O2/c21-13-7-11(1-2-12(13)10-5-16(24)19(26)17(25)6-10)30-20(27,28)18-14(22)3-9(8-29)4-15(18)23/h1-8H |
| InChIKey | FVMCTSQWANFAMX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|